C30H48O4 — CID 155522915
(E,6R)-6-[(1S,3R,6S,8R,11R,12S,13R,15R,16R)-6,13-dihydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methylhept-2-enoic acid (PubChem CID 155522915) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is (E,6R)-6-[(1S,3R,6S,8R,11R,12S,13R,15R,16R)-6,13-dihydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methylhept-2-enoic acid.
| Compound Name | (E,6R)-6-[(1S,3R,6S,8R,11R,12S,13R,15R,16R)-6,13-dihydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 155522915 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | (E,6R)-6-[(1S,3R,6S,8R,11R,12S,13R,15R,16R)-6,13-dihydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methylhept-2-enoic acid |
| SMILES | C/C(=C\CC[C@@H](C)[C@H]1C[C@@H](O)[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](O)CC[C@@]45C[C@@]35CC[C@]12C)C(=O)O |
| InChI | InChI=1S/C30H48O4/c1-18(8-7-9-19(2)25(33)34)20-16-24(32)28(6)22-11-10-21-26(3,4)23(31)12-13-29(21)17-30(22,29)15-14-27(20,28)5/h9,18,20-24,31-32H,7-8,10-17H2,1-6H3,(H,33,34)/b19-9+/t18-,20-,21+,22+,23+,24-,27-,28-,29-,30+/m1/s1 |
| InChIKey | VOAICDJSPHYTRW-WEVVXLBYSA-N |
| XLogP | 6.20 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|