C17H13F3O2S — CID 132538532
(4S,5R)-5-(4-phenylphenyl)-4-(trifluoromethylsulfanyl)oxolan-2-one (PubChem CID 132538532) has the molecular formula C17H13F3O2S and a molecular weight of 338.35 g/mol. Its IUPAC name is (4S,5R)-5-(4-phenylphenyl)-4-(trifluoromethylsulfanyl)oxolan-2-one.
| Compound Name | (4S,5R)-5-(4-phenylphenyl)-4-(trifluoromethylsulfanyl)oxolan-2-one |
|---|---|
| PubChem CID | 132538532 |
| Molecular Formula | C17H13F3O2S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (4S,5R)-5-(4-phenylphenyl)-4-(trifluoromethylsulfanyl)oxolan-2-one |
| SMILES | O=C1C[C@H](SC(F)(F)F)[C@@H](c2ccc(-c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C17H13F3O2S/c18-17(19,20)23-14-10-15(21)22-16(14)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9,14,16H,10H2/t14-,16+/m0/s1 |
| InChIKey | FXRLOAXLVIHURW-GOEBONIOSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |