C17H16FNO3 — CID 132539787
methyl (1R,2S,3S,4R)-1-cyano-4-ethenyl-2-(4-fluorophenyl)-3-formylcyclopentane-1-carboxylate (PubChem CID 132539787) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is methyl (1R,2S,3S,4R)-1-cyano-4-ethenyl-2-(4-fluorophenyl)-3-formylcyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2S,3S,4R)-1-cyano-4-ethenyl-2-(4-fluorophenyl)-3-formylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 132539787 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | methyl (1R,2S,3S,4R)-1-cyano-4-ethenyl-2-(4-fluorophenyl)-3-formylcyclopentane-1-carboxylate |
| SMILES | C=C[C@H]1C[C@@](C#N)(C(=O)OC)[C@H](c2ccc(F)cc2)[C@H]1C=O |
| InChI | InChI=1S/C17H16FNO3/c1-3-11-8-17(10-19,16(21)22-2)15(14(11)9-20)12-4-6-13(18)7-5-12/h3-7,9,11,14-15H,1,8H2,2H3/t11-,14-,15+,17-/m0/s1 |
| InChIKey | XEANRRAYTWDJIV-RMIITELYSA-N |
| XLogP | 2.61 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|