C14H17NO5 — CID 132539790
2-O-ethyl 1-O-methyl (1R,2R,3S,4R)-1-cyano-4-ethenyl-3-formylcyclopentane-1,2-dicarboxylate (PubChem CID 132539790) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 2-O-ethyl 1-O-methyl (1R,2R,3S,4R)-1-cyano-4-ethenyl-3-formylcyclopentane-1,2-dicarboxylate.
| Compound Name | 2-O-ethyl 1-O-methyl (1R,2R,3S,4R)-1-cyano-4-ethenyl-3-formylcyclopentane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 132539790 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-O-ethyl 1-O-methyl (1R,2R,3S,4R)-1-cyano-4-ethenyl-3-formylcyclopentane-1,2-dicarboxylate |
| SMILES | C=C[C@H]1C[C@@](C#N)(C(=O)OC)[C@H](C(=O)OCC)[C@H]1C=O |
| InChI | InChI=1S/C14H17NO5/c1-4-9-6-14(8-15,13(18)19-3)11(10(9)7-16)12(17)20-5-2/h4,7,9-11H,1,5-6H2,2-3H3/t9-,10-,11-,14-/m0/s1 |
| InChIKey | NRCIQXNADKYUTN-RMIALFOJSA-N |
| XLogP | 0.87 |
| TPSA | 93.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|