C14H19NO3 — CID 134965689
methyl (1R,2R,3S,4R)-1-cyano-4-ethenyl-3-formyl-2-propylcyclopentane-1-carboxylate (PubChem CID 134965689) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is methyl (1R,2R,3S,4R)-1-cyano-4-ethenyl-3-formyl-2-propylcyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2R,3S,4R)-1-cyano-4-ethenyl-3-formyl-2-propylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 134965689 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | methyl (1R,2R,3S,4R)-1-cyano-4-ethenyl-3-formyl-2-propylcyclopentane-1-carboxylate |
| SMILES | C=C[C@H]1C[C@@](C#N)(C(=O)OC)[C@H](CCC)[C@H]1C=O |
| InChI | InChI=1S/C14H19NO3/c1-4-6-12-11(8-16)10(5-2)7-14(12,9-15)13(17)18-3/h5,8,10-12H,2,4,6-7H2,1,3H3/t10-,11-,12+,14-/m0/s1 |
| InChIKey | RHOFUIRRTLPLAG-FMSGJZPZSA-N |
| XLogP | 2.11 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|