C22H23ClO6 — CID 1325401
6-chloro-4-propyl-7-[(3,4,5-trimethoxyphenyl)methoxy]chromen-2-one (PubChem CID 1325401) has the molecular formula C22H23ClO6 and a molecular weight of 418.87 g/mol. Its IUPAC name is 6-chloro-4-propyl-7-[(3,4,5-trimethoxyphenyl)methoxy]chromen-2-one.
| Compound Name | 6-chloro-4-propyl-7-[(3,4,5-trimethoxyphenyl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 1325401 |
| Molecular Formula | C22H23ClO6 |
| Molecular Weight | 418.87 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 6-chloro-4-propyl-7-[(3,4,5-trimethoxyphenyl)methoxy]chromen-2-one |
| SMILES | CCCc1cc(=O)oc2cc(OCc3cc(OC)c(OC)c(OC)c3)c(Cl)cc12 |
| InChI | InChI=1S/C22H23ClO6/c1-5-6-14-9-21(24)29-17-11-18(16(23)10-15(14)17)28-12-13-7-19(25-2)22(27-4)20(8-13)26-3/h7-11H,5-6,12H2,1-4H3 |
| InChIKey | WKUBEUINCJDMEC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.87 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|