C19H38N2O2S2 — CID 132541113
N-[(4R,6R)-6-(tert-butylsulfinylamino)-5,5-dimethylnona-1,8-dien-4-yl]-2-methylpropane-2-sulfinamide (PubChem CID 132541113) has the molecular formula C19H38N2O2S2 and a molecular weight of 390.66 g/mol. Its IUPAC name is N-[(4R,6R)-6-(tert-butylsulfinylamino)-5,5-dimethylnona-1,8-dien-4-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(4R,6R)-6-(tert-butylsulfinylamino)-5,5-dimethylnona-1,8-dien-4-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 132541113 |
| Molecular Formula | C19H38N2O2S2 |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | N-[(4R,6R)-6-(tert-butylsulfinylamino)-5,5-dimethylnona-1,8-dien-4-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC[C@@H](NS(=O)C(C)(C)C)C(C)(C)[C@@H](CC=C)NS(=O)C(C)(C)C |
| InChI | InChI=1S/C19H38N2O2S2/c1-11-13-15(20-24(22)17(3,4)5)19(9,10)16(14-12-2)21-25(23)18(6,7)8/h11-12,15-16,20-21H,1-2,13-14H2,3-10H3/t15-,16-,24?,25?/m1/s1 |
| InChIKey | IQLCMZMVGBYVBM-KTYQWQPMSA-N |
| XLogP | 4.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|