C20H41NOS — CID 135000839
(R)-N-[(5R,6R)-6-ethenyl-6-ethyldodecan-5-yl]-2-methylpropane-2-sulfinamide (PubChem CID 135000839) has the molecular formula C20H41NOS and a molecular weight of 343.62 g/mol. Its IUPAC name is (R)-N-[(5R,6R)-6-ethenyl-6-ethyldodecan-5-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(5R,6R)-6-ethenyl-6-ethyldodecan-5-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 135000839 |
| Molecular Formula | C20H41NOS |
| Molecular Weight | 343.62 g/mol |
| Exact Mass | 343.29 |
| IUPAC Name | (R)-N-[(5R,6R)-6-ethenyl-6-ethyldodecan-5-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=C[C@@](CC)(CCCCCC)[C@@H](CCCC)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C20H41NOS/c1-8-12-14-15-17-20(10-3,11-4)18(16-13-9-2)21-23(22)19(5,6)7/h10,18,21H,3,8-9,11-17H2,1-2,4-7H3/t18-,20-,23-/m1/s1 |
| InChIKey | UIUVNMBAWCSTCZ-KKLQWCBXSA-N |
| XLogP | 6.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.62 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|