C19H37NOS — CID 102333982
N-[(4R)-3-ethenyltridec-1-en-4-yl]-2-methylpropane-2-sulfinamide (PubChem CID 102333982) has the molecular formula C19H37NOS and a molecular weight of 327.58 g/mol. Its IUPAC name is N-[(4R)-3-ethenyltridec-1-en-4-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(4R)-3-ethenyltridec-1-en-4-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 102333982 |
| Molecular Formula | C19H37NOS |
| Molecular Weight | 327.58 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | N-[(4R)-3-ethenyltridec-1-en-4-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC(C=C)[C@@H](CCCCCCCCC)NS(=O)C(C)(C)C |
| InChI | InChI=1S/C19H37NOS/c1-7-10-11-12-13-14-15-16-18(17(8-2)9-3)20-22(21)19(4,5)6/h8-9,17-18,20H,2-3,7,10-16H2,1,4-6H3/t18-,22?/m1/s1 |
| InChIKey | IRSMVRYEEPMVMW-ZZWBGTBQSA-N |
| XLogP | 5.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.58 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|