C16H33NOS — CID 135006016
(R)-N-[(4R)-dodec-1-en-4-yl]-2-methylpropane-2-sulfinamide (PubChem CID 135006016) has the molecular formula C16H33NOS and a molecular weight of 287.51 g/mol. Its IUPAC name is (R)-N-[(4R)-dodec-1-en-4-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(4R)-dodec-1-en-4-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 135006016 |
| Molecular Formula | C16H33NOS |
| Molecular Weight | 287.51 g/mol |
| Exact Mass | 287.23 |
| IUPAC Name | (R)-N-[(4R)-dodec-1-en-4-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC[C@@H](CCCCCCCC)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C16H33NOS/c1-6-8-9-10-11-12-14-15(13-7-2)17-19(18)16(3,4)5/h7,15,17H,2,6,8-14H2,1,3-5H3/t15-,19+/m0/s1 |
| InChIKey | POKRCSXIJJQHKG-HNAYVOBHSA-N |
| XLogP | 4.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|