C16H32N2O2S2 — CID 11588303
(R)-N-[(4R,5R)-5-[[(R)-tert-butylsulfinyl]amino]octa-1,7-dien-4-yl]-2-methylpropane-2-sulfinamide (PubChem CID 11588303) has the molecular formula C16H32N2O2S2 and a molecular weight of 348.58 g/mol. Its IUPAC name is (R)-N-[(4R,5R)-5-[[(R)-tert-butylsulfinyl]amino]octa-1,7-dien-4-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(4R,5R)-5-[[(R)-tert-butylsulfinyl]amino]octa-1,7-dien-4-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 11588303 |
| Molecular Formula | C16H32N2O2S2 |
| Molecular Weight | 348.58 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (R)-N-[(4R,5R)-5-[[(R)-tert-butylsulfinyl]amino]octa-1,7-dien-4-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC[C@@H](N[S@](=O)C(C)(C)C)[C@@H](CC=C)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C16H32N2O2S2/c1-9-11-13(17-21(19)15(3,4)5)14(12-10-2)18-22(20)16(6,7)8/h9-10,13-14,17-18H,1-2,11-12H2,3-8H3/t13-,14-,21-,22-/m1/s1 |
| InChIKey | RUCRXJRKRGVIFK-LPINMEDASA-N |
| XLogP | 2.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|