C14H28N2O2S2 — CID 134967893
(S)-N-[(1S,6S)-6-[[(S)-tert-butylsulfinyl]amino]cyclohex-3-en-1-yl]-2-methylpropane-2-sulfinamide (PubChem CID 134967893) has the molecular formula C14H28N2O2S2 and a molecular weight of 320.52 g/mol. Its IUPAC name is (S)-N-[(1S,6S)-6-[[(S)-tert-butylsulfinyl]amino]cyclohex-3-en-1-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1S,6S)-6-[[(S)-tert-butylsulfinyl]amino]cyclohex-3-en-1-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 134967893 |
| Molecular Formula | C14H28N2O2S2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (S)-N-[(1S,6S)-6-[[(S)-tert-butylsulfinyl]amino]cyclohex-3-en-1-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)N[C@H]1CC=CC[C@@H]1N[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C14H28N2O2S2/c1-13(2,3)19(17)15-11-9-7-8-10-12(11)16-20(18)14(4,5)6/h7-8,11-12,15-16H,9-10H2,1-6H3/t11-,12-,19-,20-/m0/s1 |
| InChIKey | BULBFSLVWMUNDQ-HIGYNYDNSA-N |
| XLogP | 2.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|