C10H18FNOS — CID 56641842
(R)-N-[(1S,6R)-6-fluorocyclohex-3-en-1-yl]-2-methylpropane-2-sulfinamide (PubChem CID 56641842) has the molecular formula C10H18FNOS and a molecular weight of 219.32 g/mol. Its IUPAC name is (R)-N-[(1S,6R)-6-fluorocyclohex-3-en-1-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1S,6R)-6-fluorocyclohex-3-en-1-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 56641842 |
| Molecular Formula | C10H18FNOS |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | (R)-N-[(1S,6R)-6-fluorocyclohex-3-en-1-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@H]1CC=CC[C@H]1F |
| InChI | InChI=1S/C10H18FNOS/c1-10(2,3)14(13)12-9-7-5-4-6-8(9)11/h4-5,8-9,12H,6-7H2,1-3H3/t8-,9+,14-/m1/s1 |
| InChIKey | GZSMJNRRJMZACU-TVLCNXBWSA-N |
| XLogP | 2.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|