C11H20F3NOS — CID 175485443
tert-butyl-oxido-(1,1,7-trifluorohept-5-en-3-ylamino)sulfanium (PubChem CID 175485443) has the molecular formula C11H20F3NOS and a molecular weight of 271.35 g/mol. Its IUPAC name is tert-butyl-oxido-(1,1,7-trifluorohept-5-en-3-ylamino)sulfanium.
| Compound Name | tert-butyl-oxido-(1,1,7-trifluorohept-5-en-3-ylamino)sulfanium |
|---|---|
| PubChem CID | 175485443 |
| Molecular Formula | C11H20F3NOS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | tert-butyl-oxido-(1,1,7-trifluorohept-5-en-3-ylamino)sulfanium |
| SMILES | CC(C)(C)[S+]([O-])NC(CC=CCF)CC(F)F |
| InChI | InChI=1S/C11H20F3NOS/c1-11(2,3)17(16)15-9(8-10(13)14)6-4-5-7-12/h4-5,9-10,15H,6-8H2,1-3H3 |
| InChIKey | ZOQZRPMANIRCQW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|