C10H18F3NOS — CID 163278402
(S)-2-methyl-N-[(3R)-1,1,1-trifluorohex-5-en-3-yl]propane-2-sulfinamide (PubChem CID 163278402) has the molecular formula C10H18F3NOS and a molecular weight of 257.32 g/mol. Its IUPAC name is (S)-2-methyl-N-[(3R)-1,1,1-trifluorohex-5-en-3-yl]propane-2-sulfinamide.
| Compound Name | (S)-2-methyl-N-[(3R)-1,1,1-trifluorohex-5-en-3-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 163278402 |
| Molecular Formula | C10H18F3NOS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (S)-2-methyl-N-[(3R)-1,1,1-trifluorohex-5-en-3-yl]propane-2-sulfinamide |
| SMILES | C=CC[C@H](CC(F)(F)F)N[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C10H18F3NOS/c1-5-6-8(7-10(11,12)13)14-16(15)9(2,3)4/h5,8,14H,1,6-7H2,2-4H3/t8-,16+/m1/s1 |
| InChIKey | JJCGSUONSLJWDG-BCTVWOGZSA-N |
| XLogP | 2.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|