C8H15F2NOS — CID 140762676
N-(1,1-difluorobut-3-en-2-yl)-2-methylpropane-2-sulfinamide (PubChem CID 140762676) has the molecular formula C8H15F2NOS and a molecular weight of 211.28 g/mol. Its IUPAC name is N-(1,1-difluorobut-3-en-2-yl)-2-methylpropane-2-sulfinamide.
| Compound Name | N-(1,1-difluorobut-3-en-2-yl)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 140762676 |
| Molecular Formula | C8H15F2NOS |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | N-(1,1-difluorobut-3-en-2-yl)-2-methylpropane-2-sulfinamide |
| SMILES | C=CC(NS(=O)C(C)(C)C)C(F)F |
| InChI | InChI=1S/C8H15F2NOS/c1-5-6(7(9)10)11-13(12)8(2,3)4/h5-7,11H,1H2,2-4H3 |
| InChIKey | GYMFNAWWHMHOID-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|