C8H14F3NOS — CID 11615546
(S)-2-methyl-N-[(2S)-1,1,1-trifluorobut-3-en-2-yl]propane-2-sulfinamide (PubChem CID 11615546) has the molecular formula C8H14F3NOS and a molecular weight of 229.27 g/mol. Its IUPAC name is (S)-2-methyl-N-[(2S)-1,1,1-trifluorobut-3-en-2-yl]propane-2-sulfinamide.
| Compound Name | (S)-2-methyl-N-[(2S)-1,1,1-trifluorobut-3-en-2-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 11615546 |
| Molecular Formula | C8H14F3NOS |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | (S)-2-methyl-N-[(2S)-1,1,1-trifluorobut-3-en-2-yl]propane-2-sulfinamide |
| SMILES | C=C[C@H](N[S@@](=O)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C8H14F3NOS/c1-5-6(8(9,10)11)12-14(13)7(2,3)4/h5-6,12H,1H2,2-4H3/t6-,14-/m0/s1 |
| InChIKey | UIIBXNSTXZYMDZ-MDAAJZPYSA-N |
| XLogP | 2.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|