C9H17F2NOS — CID 163278911
N-(3,3-difluoropent-4-en-2-yl)-2-methylpropane-2-sulfinamide (PubChem CID 163278911) has the molecular formula C9H17F2NOS and a molecular weight of 225.30 g/mol. Its IUPAC name is N-(3,3-difluoropent-4-en-2-yl)-2-methylpropane-2-sulfinamide.
| Compound Name | N-(3,3-difluoropent-4-en-2-yl)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 163278911 |
| Molecular Formula | C9H17F2NOS |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | N-(3,3-difluoropent-4-en-2-yl)-2-methylpropane-2-sulfinamide |
| SMILES | C=CC(F)(F)C(C)NS(=O)C(C)(C)C |
| InChI | InChI=1S/C9H17F2NOS/c1-6-9(10,11)7(2)12-14(13)8(3,4)5/h6-7,12H,1H2,2-5H3 |
| InChIKey | FUPXRGVJIOXEIO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|