C9H16F3NOS — CID 163278607
(S)-2-methyl-N-[(2R)-1,1,1-trifluoropent-4-en-2-yl]propane-2-sulfinamide (PubChem CID 163278607) has the molecular formula C9H16F3NOS and a molecular weight of 243.29 g/mol. Its IUPAC name is (S)-2-methyl-N-[(2R)-1,1,1-trifluoropent-4-en-2-yl]propane-2-sulfinamide.
| Compound Name | (S)-2-methyl-N-[(2R)-1,1,1-trifluoropent-4-en-2-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 163278607 |
| Molecular Formula | C9H16F3NOS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (S)-2-methyl-N-[(2R)-1,1,1-trifluoropent-4-en-2-yl]propane-2-sulfinamide |
| SMILES | C=CC[C@@H](N[S@@](=O)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NOS/c1-5-6-7(9(10,11)12)13-15(14)8(2,3)4/h5,7,13H,1,6H2,2-4H3/t7-,15+/m1/s1 |
| InChIKey | QRAGSZJKUVCSHZ-MLXNANBUSA-N |
| XLogP | 2.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|