C11H21NOS — CID 46946711
(S)-N-[(4R,5E)-hepta-1,5-dien-4-yl]-2-methylpropane-2-sulfinamide (PubChem CID 46946711) has the molecular formula C11H21NOS and a molecular weight of 215.36 g/mol. Its IUPAC name is (S)-N-[(4R,5E)-hepta-1,5-dien-4-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(4R,5E)-hepta-1,5-dien-4-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 46946711 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (S)-N-[(4R,5E)-hepta-1,5-dien-4-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC[C@H](/C=C/C)N[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C11H21NOS/c1-6-8-10(9-7-2)12-14(13)11(3,4)5/h6-7,9-10,12H,1,8H2,2-5H3/b9-7+/t10-,14+/m1/s1 |
| InChIKey | RUACWIJPKUBAIS-XQFMFERDSA-N |
| XLogP | 2.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|