C10H21NOS — CID 135005878
(R)-N-[(3S)-hex-5-en-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 135005878) has the molecular formula C10H21NOS and a molecular weight of 203.35 g/mol. Its IUPAC name is (R)-N-[(3S)-hex-5-en-3-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(3S)-hex-5-en-3-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 135005878 |
| Molecular Formula | C10H21NOS |
| Molecular Weight | 203.35 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (R)-N-[(3S)-hex-5-en-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC[C@H](CC)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C10H21NOS/c1-6-8-9(7-2)11-13(12)10(3,4)5/h6,9,11H,1,7-8H2,2-5H3/t9-,13+/m0/s1 |
| InChIKey | DQPQQNBFQOVOPK-TVQRCGJNSA-N |
| XLogP | 2.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|