C15H31NOS — CID 135000629
(R)-2-methyl-N-[(E,5S)-2-methyldec-6-en-5-yl]propane-2-sulfinamide (PubChem CID 135000629) has the molecular formula C15H31NOS and a molecular weight of 273.49 g/mol. Its IUPAC name is (R)-2-methyl-N-[(E,5S)-2-methyldec-6-en-5-yl]propane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-[(E,5S)-2-methyldec-6-en-5-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 135000629 |
| Molecular Formula | C15H31NOS |
| Molecular Weight | 273.49 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (R)-2-methyl-N-[(E,5S)-2-methyldec-6-en-5-yl]propane-2-sulfinamide |
| SMILES | CCC/C=C/[C@H](CCC(C)C)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C15H31NOS/c1-7-8-9-10-14(12-11-13(2)3)16-18(17)15(4,5)6/h9-10,13-14,16H,7-8,11-12H2,1-6H3/b10-9+/t14-,18-/m1/s1 |
| InChIKey | CDAKUWSNBWCQOL-YTOTVDJJSA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|