C11H23NOS — CID 71573514
(S)-2-methyl-N-[(3R)-2-methylhex-5-en-3-yl]propane-2-sulfinamide (PubChem CID 71573514) has the molecular formula C11H23NOS and a molecular weight of 217.38 g/mol. Its IUPAC name is (S)-2-methyl-N-[(3R)-2-methylhex-5-en-3-yl]propane-2-sulfinamide.
| Compound Name | (S)-2-methyl-N-[(3R)-2-methylhex-5-en-3-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 71573514 |
| Molecular Formula | C11H23NOS |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (S)-2-methyl-N-[(3R)-2-methylhex-5-en-3-yl]propane-2-sulfinamide |
| SMILES | C=CC[C@@H](N[S@@](=O)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C11H23NOS/c1-7-8-10(9(2)3)12-14(13)11(4,5)6/h7,9-10,12H,1,8H2,2-6H3/t10-,14+/m1/s1 |
| InChIKey | ZIMKNTKRZAUXOF-YGRLFVJLSA-N |
| XLogP | 2.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|