C11H21NOS — CID 134939663
(R)-N-[(1S)-1-cyclopropylbut-3-enyl]-2-methylpropane-2-sulfinamide (PubChem CID 134939663) has the molecular formula C11H21NOS and a molecular weight of 215.36 g/mol. Its IUPAC name is (R)-N-[(1S)-1-cyclopropylbut-3-enyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1S)-1-cyclopropylbut-3-enyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 134939663 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (R)-N-[(1S)-1-cyclopropylbut-3-enyl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC[C@H](N[S@](=O)C(C)(C)C)C1CC1 |
| InChI | InChI=1S/C11H21NOS/c1-5-6-10(9-7-8-9)12-14(13)11(2,3)4/h5,9-10,12H,1,6-8H2,2-4H3/t10-,14+/m0/s1 |
| InChIKey | SIYKVJOQAHXTBS-IINYFYTJSA-N |
| XLogP | 2.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|