C11H19F2NOS — CID 163279099
N-[1-(2,2-difluorocyclopropyl)but-3-enyl]-2-methylpropane-2-sulfinamide (PubChem CID 163279099) has the molecular formula C11H19F2NOS and a molecular weight of 251.34 g/mol. Its IUPAC name is N-[1-(2,2-difluorocyclopropyl)but-3-enyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-(2,2-difluorocyclopropyl)but-3-enyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 163279099 |
| Molecular Formula | C11H19F2NOS |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-[1-(2,2-difluorocyclopropyl)but-3-enyl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CCC(NS(=O)C(C)(C)C)C1CC1(F)F |
| InChI | InChI=1S/C11H19F2NOS/c1-5-6-9(8-7-11(8,12)13)14-16(15)10(2,3)4/h5,8-9,14H,1,6-7H2,2-4H3 |
| InChIKey | JUFHEBDJJYPZPA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|