C17H33NOS — CID 134941850
(R)-N-[(E,2S)-1-cyclohexylhept-3-en-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 134941850) has the molecular formula C17H33NOS and a molecular weight of 299.52 g/mol. Its IUPAC name is (R)-N-[(E,2S)-1-cyclohexylhept-3-en-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(E,2S)-1-cyclohexylhept-3-en-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 134941850 |
| Molecular Formula | C17H33NOS |
| Molecular Weight | 299.52 g/mol |
| Exact Mass | 299.23 |
| IUPAC Name | (R)-N-[(E,2S)-1-cyclohexylhept-3-en-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CCC/C=C/[C@H](CC1CCCCC1)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C17H33NOS/c1-5-6-8-13-16(18-20(19)17(2,3)4)14-15-11-9-7-10-12-15/h8,13,15-16,18H,5-7,9-12,14H2,1-4H3/b13-8+/t16-,20-/m1/s1 |
| InChIKey | WOXXSJABLHGXKI-ZGHSMTFWSA-N |
| XLogP | 4.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|