C15H27NO2S — CID 58760675
N-[(2Z)-cyclooct-2-en-1-yl]-4-methylcyclohexane-1-sulfonamide (PubChem CID 58760675) has the molecular formula C15H27NO2S and a molecular weight of 285.45 g/mol. Its IUPAC name is N-[(2Z)-cyclooct-2-en-1-yl]-4-methylcyclohexane-1-sulfonamide.
| Compound Name | N-[(2Z)-cyclooct-2-en-1-yl]-4-methylcyclohexane-1-sulfonamide |
|---|---|
| PubChem CID | 58760675 |
| Molecular Formula | C15H27NO2S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | N-[(2Z)-cyclooct-2-en-1-yl]-4-methylcyclohexane-1-sulfonamide |
| SMILES | CC1CCC(S(=O)(=O)NC2/C=C\CCCCC2)CC1 |
| InChI | InChI=1S/C15H27NO2S/c1-13-9-11-15(12-10-13)19(17,18)16-14-7-5-3-2-4-6-8-14/h5,7,13-16H,2-4,6,8-12H2,1H3/b7-5- |
| InChIKey | BLGFOGBLSGEMPV-ALCCZGGFSA-N |
| XLogP | 3.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|