C16H31NOS — CID 135000883
(R)-N-[(E,1S)-1-cyclohexylhex-2-enyl]-2-methylpropane-2-sulfinamide (PubChem CID 135000883) has the molecular formula C16H31NOS and a molecular weight of 285.50 g/mol. Its IUPAC name is (R)-N-[(E,1S)-1-cyclohexylhex-2-enyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(E,1S)-1-cyclohexylhex-2-enyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 135000883 |
| Molecular Formula | C16H31NOS |
| Molecular Weight | 285.50 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (R)-N-[(E,1S)-1-cyclohexylhex-2-enyl]-2-methylpropane-2-sulfinamide |
| SMILES | CCC/C=C/[C@@H](N[S@](=O)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C16H31NOS/c1-5-6-8-13-15(14-11-9-7-10-12-14)17-19(18)16(2,3)4/h8,13-15,17H,5-7,9-12H2,1-4H3/b13-8+/t15-,19-/m1/s1 |
| InChIKey | NUTGYUHCLOMBAV-SCWCHKEVSA-N |
| XLogP | 4.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|