C16H29NOS — CID 139093106
(R)-N-[(1R)-1-cyclohexyl-2-ethenylbut-3-enyl]-2-methylpropane-2-sulfinamide (PubChem CID 139093106) has the molecular formula C16H29NOS and a molecular weight of 283.48 g/mol. Its IUPAC name is (R)-N-[(1R)-1-cyclohexyl-2-ethenylbut-3-enyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1R)-1-cyclohexyl-2-ethenylbut-3-enyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 139093106 |
| Molecular Formula | C16H29NOS |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | (R)-N-[(1R)-1-cyclohexyl-2-ethenylbut-3-enyl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC(C=C)[C@H](N[S@](=O)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C16H29NOS/c1-6-13(7-2)15(14-11-9-8-10-12-14)17-19(18)16(3,4)5/h6-7,13-15,17H,1-2,8-12H2,3-5H3/t15-,19+/m0/s1 |
| InChIKey | KTNTWKOLKFFLJF-HNAYVOBHSA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|