C24H46N2O4S2 — CID 134999210
N-[(E,1R,4R)-4-(tert-butylsulfonylamino)-1,4-dicyclohexylbut-2-enyl]-2-methylpropane-2-sulfonamide (PubChem CID 134999210) has the molecular formula C24H46N2O4S2 and a molecular weight of 490.78 g/mol. Its IUPAC name is N-[(E,1R,4R)-4-(tert-butylsulfonylamino)-1,4-dicyclohexylbut-2-enyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[(E,1R,4R)-4-(tert-butylsulfonylamino)-1,4-dicyclohexylbut-2-enyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 134999210 |
| Molecular Formula | C24H46N2O4S2 |
| Molecular Weight | 490.78 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | N-[(E,1R,4R)-4-(tert-butylsulfonylamino)-1,4-dicyclohexylbut-2-enyl]-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)N[C@@H](/C=C/[C@H](NS(=O)(=O)C(C)(C)C)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H46N2O4S2/c1-23(2,3)31(27,28)25-21(19-13-9-7-10-14-19)17-18-22(20-15-11-8-12-16-20)26-32(29,30)24(4,5)6/h17-22,25-26H,7-16H2,1-6H3/b18-17+/t21-,22-/m0/s1 |
| InChIKey | PZYCAWMHCQUSAM-TYMMGGBDSA-N |
| XLogP | 4.88 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.78 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|