C28H54N2O4S2 — CID 24749885
N-[(9R,10E,12R)-12-(tert-butylsulfonylamino)icosa-1,10,19-trien-9-yl]-2-methylpropane-2-sulfonamide (PubChem CID 24749885) has the molecular formula C28H54N2O4S2 and a molecular weight of 546.88 g/mol. Its IUPAC name is N-[(9R,10E,12R)-12-(tert-butylsulfonylamino)icosa-1,10,19-trien-9-yl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[(9R,10E,12R)-12-(tert-butylsulfonylamino)icosa-1,10,19-trien-9-yl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 24749885 |
| Molecular Formula | C28H54N2O4S2 |
| Molecular Weight | 546.88 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | N-[(9R,10E,12R)-12-(tert-butylsulfonylamino)icosa-1,10,19-trien-9-yl]-2-methylpropane-2-sulfonamide |
| SMILES | C=CCCCCCC[C@H](/C=C/[C@@H](CCCCCCC=C)NS(=O)(=O)C(C)(C)C)NS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C28H54N2O4S2/c1-9-11-13-15-17-19-21-25(29-35(31,32)27(3,4)5)23-24-26(22-20-18-16-14-12-10-2)30-36(33,34)28(6,7)8/h9-10,23-26,29-30H,1-2,11-22H2,3-8H3/b24-23+/t25-,26-/m1/s1 |
| InChIKey | ZRIGEPIFDLJTKW-WOMBWFPISA-N |
| XLogP | 6.77 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.88 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|