C13H25NO2S — CID 102388633
N-(2-butylcyclopent-2-en-1-yl)-2-methylpropane-2-sulfonamide (PubChem CID 102388633) has the molecular formula C13H25NO2S and a molecular weight of 259.41 g/mol. Its IUPAC name is N-(2-butylcyclopent-2-en-1-yl)-2-methylpropane-2-sulfonamide.
| Compound Name | N-(2-butylcyclopent-2-en-1-yl)-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 102388633 |
| Molecular Formula | C13H25NO2S |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | N-(2-butylcyclopent-2-en-1-yl)-2-methylpropane-2-sulfonamide |
| SMILES | CCCCC1=CCCC1NS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C13H25NO2S/c1-5-6-8-11-9-7-10-12(11)14-17(15,16)13(2,3)4/h9,12,14H,5-8,10H2,1-4H3 |
| InChIKey | SIHRJRHTLUDPNX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|