C32H66N2O4S2 — CID 11657324
N-[(E,11R,14R)-14-(tert-butylsulfonylamino)tetracos-12-en-11-yl]-2-methylpropane-2-sulfonamide (PubChem CID 11657324) has the molecular formula C32H66N2O4S2 and a molecular weight of 607.02 g/mol. Its IUPAC name is N-[(E,11R,14R)-14-(tert-butylsulfonylamino)tetracos-12-en-11-yl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[(E,11R,14R)-14-(tert-butylsulfonylamino)tetracos-12-en-11-yl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 11657324 |
| Molecular Formula | C32H66N2O4S2 |
| Molecular Weight | 607.02 g/mol |
| Exact Mass | 606.45 |
| IUPAC Name | N-[(E,11R,14R)-14-(tert-butylsulfonylamino)tetracos-12-en-11-yl]-2-methylpropane-2-sulfonamide |
| SMILES | CCCCCCCCCC[C@H](/C=C/[C@@H](CCCCCCCCCC)NS(=O)(=O)C(C)(C)C)NS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C32H66N2O4S2/c1-9-11-13-15-17-19-21-23-25-29(33-39(35,36)31(3,4)5)27-28-30(34-40(37,38)32(6,7)8)26-24-22-20-18-16-14-12-10-2/h27-30,33-34H,9-26H2,1-8H3/b28-27+/t29-,30-/m1/s1 |
| InChIKey | DYILKWVURJVNMM-CQZOVRHBSA-N |
| XLogP | 8.78 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.02 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|