C20H38N2O4S2 — CID 134996783
N-[(5R,6E,8R)-8-(tert-butylsulfonylamino)dodeca-1,6,11-trien-5-yl]-2-methylpropane-2-sulfonamide (PubChem CID 134996783) has the molecular formula C20H38N2O4S2 and a molecular weight of 434.67 g/mol. Its IUPAC name is N-[(5R,6E,8R)-8-(tert-butylsulfonylamino)dodeca-1,6,11-trien-5-yl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[(5R,6E,8R)-8-(tert-butylsulfonylamino)dodeca-1,6,11-trien-5-yl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 134996783 |
| Molecular Formula | C20H38N2O4S2 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[(5R,6E,8R)-8-(tert-butylsulfonylamino)dodeca-1,6,11-trien-5-yl]-2-methylpropane-2-sulfonamide |
| SMILES | C=CCC[C@H](/C=C/[C@@H](CCC=C)NS(=O)(=O)C(C)(C)C)NS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C20H38N2O4S2/c1-9-11-13-17(21-27(23,24)19(3,4)5)15-16-18(14-12-10-2)22-28(25,26)20(6,7)8/h9-10,15-18,21-22H,1-2,11-14H2,3-8H3/b16-15+/t17-,18-/m1/s1 |
| InChIKey | UBTMWWISWNCSJQ-LPFZIDKWSA-N |
| XLogP | 3.65 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|