C20H42N2O4S2 — CID 101396861
N-[(E,3S,6S)-6-(tert-butylsulfonylamino)-2,2,7,7-tetramethyloct-4-en-3-yl]-2-methylpropane-2-sulfonamide (PubChem CID 101396861) has the molecular formula C20H42N2O4S2 and a molecular weight of 438.70 g/mol. Its IUPAC name is N-[(E,3S,6S)-6-(tert-butylsulfonylamino)-2,2,7,7-tetramethyloct-4-en-3-yl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[(E,3S,6S)-6-(tert-butylsulfonylamino)-2,2,7,7-tetramethyloct-4-en-3-yl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 101396861 |
| Molecular Formula | C20H42N2O4S2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | N-[(E,3S,6S)-6-(tert-butylsulfonylamino)-2,2,7,7-tetramethyloct-4-en-3-yl]-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)[C@H](/C=C/[C@H](NS(=O)(=O)C(C)(C)C)C(C)(C)C)NS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C20H42N2O4S2/c1-17(2,3)15(21-27(23,24)19(7,8)9)13-14-16(18(4,5)6)22-28(25,26)20(10,11)12/h13-16,21-22H,1-12H3/b14-13+/t15-,16-/m0/s1 |
| InChIKey | NTEGFJCZFBYIAQ-QKMFHXBFSA-N |
| XLogP | 3.81 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|