C9H17NO2S — CID 24749771
N-[(1S)-cyclopent-2-en-1-yl]-2-methylpropane-2-sulfonamide (PubChem CID 24749771) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is N-[(1S)-cyclopent-2-en-1-yl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[(1S)-cyclopent-2-en-1-yl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 24749771 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | N-[(1S)-cyclopent-2-en-1-yl]-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)N[C@@H]1C=CCC1 |
| InChI | InChI=1S/C9H17NO2S/c1-9(2,3)13(11,12)10-8-6-4-5-7-8/h4,6,8,10H,5,7H2,1-3H3/t8-/m1/s1 |
| InChIKey | KWSLWDUPHSGRFN-MRVPVSSYSA-N |
| XLogP | 1.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|