C11H23NOS — CID 134945442
(R)-N-[(E,2S)-hept-5-en-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 134945442) has the molecular formula C11H23NOS and a molecular weight of 217.38 g/mol. Its IUPAC name is (R)-N-[(E,2S)-hept-5-en-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(E,2S)-hept-5-en-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 134945442 |
| Molecular Formula | C11H23NOS |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (R)-N-[(E,2S)-hept-5-en-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C/C=C/CC[C@H](C)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C11H23NOS/c1-6-7-8-9-10(2)12-14(13)11(3,4)5/h6-7,10,12H,8-9H2,1-5H3/b7-6+/t10-,14+/m0/s1 |
| InChIKey | CWJHWOWUXAMKGO-RCUAZDOOSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|