C22H46N2O4S2 — CID 101396854
N-[(E)-9-(tert-butylsulfonylamino)tetradec-7-en-6-yl]-2-methylpropane-2-sulfonamide (PubChem CID 101396854) has the molecular formula C22H46N2O4S2 and a molecular weight of 466.75 g/mol. Its IUPAC name is N-[(E)-9-(tert-butylsulfonylamino)tetradec-7-en-6-yl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[(E)-9-(tert-butylsulfonylamino)tetradec-7-en-6-yl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 101396854 |
| Molecular Formula | C22H46N2O4S2 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | N-[(E)-9-(tert-butylsulfonylamino)tetradec-7-en-6-yl]-2-methylpropane-2-sulfonamide |
| SMILES | CCCCCC(/C=C/C(CCCCC)NS(=O)(=O)C(C)(C)C)NS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C22H46N2O4S2/c1-9-11-13-15-19(23-29(25,26)21(3,4)5)17-18-20(16-14-12-10-2)24-30(27,28)22(6,7)8/h17-20,23-24H,9-16H2,1-8H3/b18-17+ |
| InChIKey | HWUJEWACRXVCGJ-ISLYRVAYSA-N |
| XLogP | 4.88 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|