C10H19NOS — CID 118540667
(R)-2-methyl-N-[(1R)-2-methylcyclopent-2-en-1-yl]propane-2-sulfinamide (PubChem CID 118540667) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is (R)-2-methyl-N-[(1R)-2-methylcyclopent-2-en-1-yl]propane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-[(1R)-2-methylcyclopent-2-en-1-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 118540667 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (R)-2-methyl-N-[(1R)-2-methylcyclopent-2-en-1-yl]propane-2-sulfinamide |
| SMILES | CC1=CCC[C@H]1N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C10H19NOS/c1-8-6-5-7-9(8)11-13(12)10(2,3)4/h6,9,11H,5,7H2,1-4H3/t9-,13-/m1/s1 |
| InChIKey | MCNJGZDXASRAIO-NOZJJQNGSA-N |
| XLogP | 2.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|