C44H86N2O4S2 — CID 134926391
N-[(E,11S,14S)-14-(tert-butylsulfonylamino)-11,14-dicyclohexyltetracos-12-en-11-yl]-2-methylpropane-2-sulfonamide (PubChem CID 134926391) has the molecular formula C44H86N2O4S2 and a molecular weight of 771.32 g/mol. Its IUPAC name is N-[(E,11S,14S)-14-(tert-butylsulfonylamino)-11,14-dicyclohexyltetracos-12-en-11-yl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[(E,11S,14S)-14-(tert-butylsulfonylamino)-11,14-dicyclohexyltetracos-12-en-11-yl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 134926391 |
| Molecular Formula | C44H86N2O4S2 |
| Molecular Weight | 771.32 g/mol |
| Exact Mass | 770.60 |
| IUPAC Name | N-[(E,11S,14S)-14-(tert-butylsulfonylamino)-11,14-dicyclohexyltetracos-12-en-11-yl]-2-methylpropane-2-sulfonamide |
| SMILES | CCCCCCCCCC[C@](/C=C/[C@@](CCCCCCCCCC)(NS(=O)(=O)C(C)(C)C)C1CCCCC1)(NS(=O)(=O)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C44H86N2O4S2/c1-9-11-13-15-17-19-21-29-35-43(39-31-25-23-26-32-39,45-51(47,48)41(3,4)5)37-38-44(40-33-27-24-28-34-40,46-52(49,50)42(6,7)8)36-30-22-20-18-16-14-12-10-2/h37-40,45-46H,9-36H2,1-8H3/b38-37+/t43-,44-/m1/s1 |
| InChIKey | MVPSSNFILLVPAJ-JYBUGWPSSA-N |
| XLogP | 12.68 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.32 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|