C32H62N2O4S2 — CID 134926514
N-[(E,3S,6S)-6-(tert-butylsulfonylamino)-3,6-dicyclohexyl-2,2,7,7-tetramethyloct-4-en-3-yl]-2-methylpropane-2-sulfonamide (PubChem CID 134926514) has the molecular formula C32H62N2O4S2 and a molecular weight of 602.99 g/mol. Its IUPAC name is N-[(E,3S,6S)-6-(tert-butylsulfonylamino)-3,6-dicyclohexyl-2,2,7,7-tetramethyloct-4-en-3-yl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[(E,3S,6S)-6-(tert-butylsulfonylamino)-3,6-dicyclohexyl-2,2,7,7-tetramethyloct-4-en-3-yl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 134926514 |
| Molecular Formula | C32H62N2O4S2 |
| Molecular Weight | 602.99 g/mol |
| Exact Mass | 602.42 |
| IUPAC Name | N-[(E,3S,6S)-6-(tert-butylsulfonylamino)-3,6-dicyclohexyl-2,2,7,7-tetramethyloct-4-en-3-yl]-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)[C@](/C=C/[C@@](NS(=O)(=O)C(C)(C)C)(C1CCCCC1)C(C)(C)C)(NS(=O)(=O)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C32H62N2O4S2/c1-27(2,3)31(25-19-15-13-16-20-25,33-39(35,36)29(7,8)9)23-24-32(28(4,5)6,26-21-17-14-18-22-26)34-40(37,38)30(10,11)12/h23-26,33-34H,13-22H2,1-12H3/b24-23+/t31-,32-/m1/s1 |
| InChIKey | YURCEURCWNNMER-IXBUGTFESA-N |
| XLogP | 7.71 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.99 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|