C17H35NOS — CID 135006017
(R)-2-methyl-N-[(4R)-2-methyldodec-1-en-4-yl]propane-2-sulfinamide (PubChem CID 135006017) has the molecular formula C17H35NOS and a molecular weight of 301.54 g/mol. Its IUPAC name is (R)-2-methyl-N-[(4R)-2-methyldodec-1-en-4-yl]propane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-[(4R)-2-methyldodec-1-en-4-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 135006017 |
| Molecular Formula | C17H35NOS |
| Molecular Weight | 301.54 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (R)-2-methyl-N-[(4R)-2-methyldodec-1-en-4-yl]propane-2-sulfinamide |
| SMILES | C=C(C)C[C@@H](CCCCCCCC)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C17H35NOS/c1-7-8-9-10-11-12-13-16(14-15(2)3)18-20(19)17(4,5)6/h16,18H,2,7-14H2,1,3-6H3/t16-,20-/m1/s1 |
| InChIKey | ITYUSVUCIIANLP-OXQOHEQNSA-N |
| XLogP | 5.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|