C12H22FNOS — CID 56641841
(R)-N-[(4S,5R)-5-fluoroocta-1,7-dien-4-yl]-2-methylpropane-2-sulfinamide (PubChem CID 56641841) has the molecular formula C12H22FNOS and a molecular weight of 247.38 g/mol. Its IUPAC name is (R)-N-[(4S,5R)-5-fluoroocta-1,7-dien-4-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(4S,5R)-5-fluoroocta-1,7-dien-4-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 56641841 |
| Molecular Formula | C12H22FNOS |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (R)-N-[(4S,5R)-5-fluoroocta-1,7-dien-4-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC[C@@H](F)[C@H](CC=C)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C12H22FNOS/c1-6-8-10(13)11(9-7-2)14-16(15)12(3,4)5/h6-7,10-11,14H,1-2,8-9H2,3-5H3/t10-,11+,16-/m1/s1 |
| InChIKey | PHIHZPOGVTXASB-OHUAYANFSA-N |
| XLogP | 2.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|