C25H38O5Si — CID 132542220
2-[4,5-dimethoxy-2-tri(propan-2-yl)silyloxyphenyl]-6-methoxy-4-methylphenol (PubChem CID 132542220) has the molecular formula C25H38O5Si and a molecular weight of 446.66 g/mol. Its IUPAC name is 2-[4,5-dimethoxy-2-tri(propan-2-yl)silyloxyphenyl]-6-methoxy-4-methylphenol.
| Compound Name | 2-[4,5-dimethoxy-2-tri(propan-2-yl)silyloxyphenyl]-6-methoxy-4-methylphenol |
|---|---|
| PubChem CID | 132542220 |
| Molecular Formula | C25H38O5Si |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 2-[4,5-dimethoxy-2-tri(propan-2-yl)silyloxyphenyl]-6-methoxy-4-methylphenol |
| SMILES | COc1cc(O[Si](C(C)C)(C(C)C)C(C)C)c(-c2cc(C)cc(OC)c2O)cc1OC |
| InChI | InChI=1S/C25H38O5Si/c1-15(2)31(16(3)4,17(5)6)30-21-14-23(28-9)22(27-8)13-19(21)20-11-18(7)12-24(29-10)25(20)26/h11-17,26H,1-10H3 |
| InChIKey | FZQDDKVMZBXEIA-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|