C36H30O2 — CID 132542324
1,5-dimethoxy-2,4-bis[1-(4-phenylphenyl)ethenyl]benzene (PubChem CID 132542324) has the molecular formula C36H30O2 and a molecular weight of 494.63 g/mol. Its IUPAC name is 1,5-dimethoxy-2,4-bis[1-(4-phenylphenyl)ethenyl]benzene.
| Compound Name | 1,5-dimethoxy-2,4-bis[1-(4-phenylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 132542324 |
| Molecular Formula | C36H30O2 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 1,5-dimethoxy-2,4-bis[1-(4-phenylphenyl)ethenyl]benzene |
| SMILES | C=C(c1ccc(-c2ccccc2)cc1)c1cc(C(=C)c2ccc(-c3ccccc3)cc2)c(OC)cc1OC |
| InChI | InChI=1S/C36H30O2/c1-25(27-15-19-31(20-16-27)29-11-7-5-8-12-29)33-23-34(36(38-4)24-35(33)37-3)26(2)28-17-21-32(22-18-28)30-13-9-6-10-14-30/h5-24H,1-2H2,3-4H3 |
| InChIKey | VURHPZSRQSVUTH-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |