About benzyl 4-(1,3-diphenylpropan-2-ylidene)cyclopentene-1-carboxylate
benzyl 4-(1,3-diphenylpropan-2-ylidene)cyclopentene-1-carboxylate (PubChem CID 132543741) has the molecular formula C28H26O2
and a molecular weight of 394.51 g/mol. Its IUPAC name is benzyl 4-(1,3-diphenylpropan-2-ylidene)cyclopentene-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-(1,3-diphenylpropan-2-ylidene)cyclopentene-1-carboxylate |
| PubChem CID | 132543741 |
| Molecular Formula | C28H26O2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | benzyl 4-(1,3-diphenylpropan-2-ylidene)cyclopentene-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1=CCC(=C(Cc2ccccc2)Cc2ccccc2)C1 |
| InChI | InChI=1S/C28H26O2/c29-28(30-21-24-14-8-3-9-15-24)26-17-16-25(20-26)27(18-22-10-4-1-5-11-22)19-23-12-6-2-7-13-23/h1-15,17H,16,18-21H2 |
| InChIKey | XAJRYFCXRPLPDT-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzyl 4-(1,3-diphenylpropan-2-ylidene)cyclopentene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-(1,3-diphenylpropan-2-ylidene)cyclopentene-1-carboxylate?
The IUPAC name of benzyl 4-(1,3-diphenylpropan-2-ylidene)cyclopentene-1-carboxylate (CID 132543741) is benzyl 4-(1,3-diphenylpropan-2-ylidene)cyclopentene-1-carboxylate.
What is the SMILES notation for benzyl 4-(1,3-diphenylpropan-2-ylidene)cyclopentene-1-carboxylate?
The canonical SMILES for benzyl 4-(1,3-diphenylpropan-2-ylidene)cyclopentene-1-carboxylate is O=C(OCc1ccccc1)C1=CCC(=C(Cc2ccccc2)Cc2ccccc2)C1.
What is the InChIKey of benzyl 4-(1,3-diphenylpropan-2-ylidene)cyclopentene-1-carboxylate?
The InChIKey is XAJRYFCXRPLPDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26O2/c29-28(30-21-24-14-8-3-9-15-24)26-17-16-25(20-26)27(18-22-10-4-1-5-11-22)19-23-12-6-2-7-13-23/h1-15,17H,16,18-21H2.
What are the key properties of benzyl 4-(1,3-diphenylpropan-2-ylidene)cyclopentene-1-carboxylate?
benzyl 4-(1,3-diphenylpropan-2-ylidene)cyclopentene-1-carboxylate has a molecular weight of 394.51 g/mol, XLogP of 6.23, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(1,3-diphenylpropan-2-ylidene)cyclopentene-1-carboxylate is sourced from PubChem (CID 132543741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).