C28H33NO3Si — CID 132544912
3-[3,5-bis(4-methoxyphenyl)-2-pyridinyl]prop-2-ynoxy-triethylsilane (PubChem CID 132544912) has the molecular formula C28H33NO3Si and a molecular weight of 459.66 g/mol. Its IUPAC name is 3-[3,5-bis(4-methoxyphenyl)-2-pyridinyl]prop-2-ynoxy-triethylsilane.
| Compound Name | 3-[3,5-bis(4-methoxyphenyl)-2-pyridinyl]prop-2-ynoxy-triethylsilane |
|---|---|
| PubChem CID | 132544912 |
| Molecular Formula | C28H33NO3Si |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 3-[3,5-bis(4-methoxyphenyl)-2-pyridinyl]prop-2-ynoxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OCC#Cc1ncc(-c2ccc(OC)cc2)cc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H33NO3Si/c1-6-33(7-2,8-3)32-19-9-10-28-27(23-13-17-26(31-5)18-14-23)20-24(21-29-28)22-11-15-25(30-4)16-12-22/h11-18,20-21H,6-8,19H2,1-5H3 |
| InChIKey | PDDNMZJTTLLGNE-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|