C13H16BrF3N2 — CID 132545729
(3-bromophenyl)-(1,1,1-trifluoroheptan-3-yl)diazene (PubChem CID 132545729) has the molecular formula C13H16BrF3N2 and a molecular weight of 337.18 g/mol. Its IUPAC name is (3-bromophenyl)-(1,1,1-trifluoroheptan-3-yl)diazene.
| Compound Name | (3-bromophenyl)-(1,1,1-trifluoroheptan-3-yl)diazene |
|---|---|
| PubChem CID | 132545729 |
| Molecular Formula | C13H16BrF3N2 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | (3-bromophenyl)-(1,1,1-trifluoroheptan-3-yl)diazene |
| SMILES | CCCCC(CC(F)(F)F)/N=N/c1cccc(Br)c1 |
| InChI | InChI=1S/C13H16BrF3N2/c1-2-3-6-12(9-13(15,16)17)19-18-11-7-4-5-10(14)8-11/h4-5,7-8,12H,2-3,6,9H2,1H3/b19-18+ |
| InChIKey | JGXUSUMJLFJMRA-VHEBQXMUSA-N |
| XLogP | 6.04 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|