C12H19BrN2 — CID 65377694
2-N-(3-bromophenyl)hexane-1,2-diamine (PubChem CID 65377694) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 2-N-(3-bromophenyl)hexane-1,2-diamine.
| Compound Name | 2-N-(3-bromophenyl)hexane-1,2-diamine |
|---|---|
| PubChem CID | 65377694 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-N-(3-bromophenyl)hexane-1,2-diamine |
| SMILES | CCCCC(CN)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C12H19BrN2/c1-2-3-6-12(9-14)15-11-7-4-5-10(13)8-11/h4-5,7-8,12,15H,2-3,6,9,14H2,1H3 |
| InChIKey | YZEBWOPAKVKYAP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |