C13H20N4 — CID 67337922
2-N-(1H-indazol-5-yl)hexane-1,2-diamine (PubChem CID 67337922) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-N-(1H-indazol-5-yl)hexane-1,2-diamine.
| Compound Name | 2-N-(1H-indazol-5-yl)hexane-1,2-diamine |
|---|---|
| PubChem CID | 67337922 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2-N-(1H-indazol-5-yl)hexane-1,2-diamine |
| SMILES | CCCCC(CN)Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C13H20N4/c1-2-3-4-12(8-14)16-11-5-6-13-10(7-11)9-15-17-13/h5-7,9,12,16H,2-4,8,14H2,1H3,(H,15,17) |
| InChIKey | MXGDVPGISNZFOM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |